- Chemical Name Benzocyclobutene-4-boronic acid
- CAS No. 195730-31-5
- Contact Us Inquiry
Quality Factory Supply 99% Pure Benzocyclobutene-4-boronic acid 195730-31-5 with Efficient Delivery We provide high quality Benzocyclobutene-4-boronic acid (CAS 195730-31-5), at a very affordable prices to our customers.
1.What is the Benzocyclobutene-4-boronic acid ?
Benzocyclobutene-4-boronic acid is a boronic acid derivative featuring a benzocyclobutene ring, which serves as a versatile building block in organic synthesis. Its unique molecular structure and ability to engage in various chemical reactions, such as Suzuki-Miyaura cross-coupling, render it a valuable component in the creation of complex organic molecules and the development of novel materials with specific properties.
Used in Pharmaceutical Synthesis:
Benzocyclobutene-4-boronic acid is used as a key intermediate in the synthesis of pharmaceuticals for its ability to facilitate the construction of complex organic molecules, contributing to the development of new drugs with enhanced therapeutic properties.
Used in Agrochemical Development:
In the agrochemical industry, Benzocyclobutene-4-boronic acid is utilized as a precursor in the synthesis of various agrochemicals, enabling the creation of effective compounds for crop protection and enhancement of agricultural productivity.
Used in Materials Science:
Benzocyclobutene-4-boronic acid is employed as a component in the development of novel materials with specific properties, leveraging its unique molecular structure to engineer materials with tailored characteristics for diverse applications in science and industry.
2.What is the CAS number for Benzocyclobutene-4-boronic acid ?
The CAS number of Benzocyclobutene-4-boronic acid is 195730-31-5.
More information of Benzocyclobutene-4-boronic acid 195730-31-5 are:
|
CAS?Number |
195730-31-5 |
|
Density |
1.22 g/cm3 |
|
Boiling Point |
328.5 °C at 760 mmHg |
|
Flash Point |
152.5 °C |
|
Vapor Pressure |
7.63E-05mmHg at 25°C |
|
Refractive Index |
1.587 |
|
HS CODE |
2931900090 |
|
PSA |
40.46000 |
|
LogP |
-0.14980 |
|
Pka |
8.88±0.20(Predicted) |
3.What is the molecular formula of Benzocyclobutene-4-boronic acid ?
The chemical formula of?Benzocyclobutene-4-boronic acid is C8H9BO2 which containing 8 Carbon atoms,9 Hydrogen atoms,1 Boron atoms and 2 Oxygen atoms,and the molecular weight, and the molecular weight of Benzocyclobutene-4-boronic acid is 147.969
4.What is Benzocyclobutene-4-boronic acid(195730-31-5)used for?
Benzocyclobutene-4-boronic acid is a boronic acid derivative featuring a benzocyclobutene ring, which serves as a versatile building block in organic synthesis. Its unique molecular structure and ability to engage in various chemical reactions, such as Suzuki-Miyaura cross-coupling, render it a valuable component in the creation of complex organic molecules and the development of novel materials with specific properties.
InChI:InChI=1/C8H9BO2/c10-9(11)8-4-3-6-1-2-7(6)5-8/h3-5,10-11H,1-2H2
Relevant articles related to Benzocyclobutene-4-boronic acid:
|
Article |
Source |
|
An efficient route to biaryl bisbenzocyclobutene monomers based on Suzuki coupling reaction at room temperature |
Yang, Jun-Xiao,Ma, Kuo-Yan,Zhu, Fang-Hua,Chen, Wen,Li, Bo,Zhang, Lin,Xie, Ru-Gang , p. 184 - 186 (2007/10/03) |
5.Quality Factory Supply 99% Pure Benzocyclobutene-4-boronic acid 195730-31-5 with Efficient Delivery
hangzhou xinnongsheng chemicals .,co,ltd. is a quality supplier of Benzocyclobutene-4-boronic acid. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on Benzocyclobutene-4-boronic acid 195730-31-5.